Home
Products
Bacopasaponin C
| Product Name | Bacopasaponin C |
| Price: | $263 / 5mg |
| Catalog No.: | CN07269 |
| CAS No.: | 178064-13-6 |
| Molecular Formula: | C46H74O17 |
| Molecular Weight: | 899.08 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Bacopa monnieri |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@@H]1O[C@H]([C@@H]([C@H]1O)O)O[C@H]1[C@@H](OC[C@@H]([C@@H]1O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O)O[C@H]1CC[C@]2([C@H](C1(C)C)CC[C@@]1([C@@H]2CC[C@H]2[C@@]31CO[C@]1(C3)[C@@H]2[C@@](C)(O)[C@@H](CO1)C=C(C)C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Bacopasaponin C is an indigenous glycoside isolated from Bacopa monniera, with antitumor and anti-leishmanial activities[1][2]. |
| Density | 1.4±0.0 g/cm3 |
| Exact Mass | 898.492615 |
| PSA | 255.91000 |
| LogP | 3.87 |
| Storage condition | 2-8°C |