Home
Products
2',4'-Dihydroxychalcone
| Product Name | 2',4'-Dihydroxychalcone |
| Price: | Inquiry |
| Catalog No.: | CN05596 |
| CAS No.: | 1776-30-3 |
| Molecular Formula: | C15H12O3 |
| Molecular Weight: | 240.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Chalcones |
| Physical Desc.: | Powder |
| Source: | The resins of Dracaena draco |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc(c(c1)O)C(=O)C=Cc1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.286g/cm3 |
| Boiling Point | 453.5ºC at 760 mmHg |
| Flash Point | 242.2ºC |
| Exact Mass | 240.07900 |
| PSA | 57.53000 |
| LogP | 2.99390 |
| Vapour Pressure | 7.64E-09mmHg at 25°C |