Home
Products
Neoruscogenin
| Product Name | Neoruscogenin |
| Price: | $409 / 10mg |
| Catalog No.: | CN02338 |
| CAS No.: | 17676-33-4 |
| Molecular Formula: | C27H40O4 |
| Molecular Weight: | 428.61 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The herbs of Ruscus aculeatus |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@H]1C[C@@H](O)[C@]2(C(=CC[C@@H]3[C@@H]2CC[C@]2([C@H]3C[C@H]3[C@@H]2[C@H](C)[C@]2(O3)CCC(=C)CO2)C)C1)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Neoruscogenin, a member of the steroidal sapogenin family, is a bioavailable, potent, and high-affinity agonist of the nuclear receptor RORα (NR1F1)[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 566.6±50.0 °C at 760 mmHg |
| Flash Point | 296.4±30.1 °C |
| Exact Mass | 428.292664 |
| PSA | 58.92000 |
| LogP | 4.21 |
| Vapour Pressure | 0.0±3.5 mmHg at 25°C |