Home
Products
Phorbol
| Product Name | Phorbol |
| Price: | $234 / 10mg |
| Catalog No.: | CN08564 |
| CAS No.: | 17673-25-5 |
| Molecular Formula: | C20H28O6 |
| Molecular Weight: | 364.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Euphorbia pekinensis Rupr. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OCC1=CC2C3C(C3(C)C)(O)C(C(C2(C2C(C1)(O)C(=O)C(=C2)C)O)C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Phorbol is a highly toxic diterpene, whose esters have important biological properties. |
| Density | 1.415 g/cm3 |
| Boiling Point | 572ºC at 760 mmHg |
| Flash Point | 313.8ºC |
| Exact Mass | 364.18900 |
| PSA | 118.22000 |
| Vapour Pressure | 1.83E-15mmHg at 25°C |
| Storage condition | -20°C |