Home
Products
Scutebarbatine A
| Product Name | Scutebarbatine A |
| Price: | Inquiry |
| Catalog No.: | CN08890 |
| CAS No.: | 176520-13-1 |
| Molecular Formula: | C32H34N2O7 |
| Molecular Weight: | 558.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Scutellaria barbata D. Don |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1OCC(=C1)C=CC1(C)C2CCC=C(C2(C)C(C(C1(C)O)OC(=O)c1cccnc1)OC(=O)c1cccnc1)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Scutebarbatine A inhibits the proliferation of HCC cells and triggers their apoptosis via the activation of MAPK and ER stress[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 742.1±60.0 °C at 760 mmHg |
| Flash Point | 402.6±32.9 °C |
| Exact Mass | 558.236572 |
| PSA | 124.91000 |
| LogP | 4.01 |
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |