Home
Products
16alpha-Hydroxydehydrotrametenolic acid
| Product Name | 16alpha-Hydroxydehydrotrametenolic acid |
| Price: | $366 / 5mg |
| Catalog No.: | CN07529 |
| CAS No.: | 176390-66-2 |
| Molecular Formula: | C30H46O4 |
| Molecular Weight: | 470.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The sclerotium of Poria cocos(Schw.) Wolf |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCCC(C1C(O)CC2(C1(C)CC=C1C2=CCC2C1(C)CCC(C2(C)C)O)C)C(=O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 16α-Hydroxydehydrotrametenolic acid is a triterpene Acid in fermented mycelia of edible fungus Poria cocos[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 617.6±55.0 °C at 760 mmHg |
| Flash Point | 341.3±28.0 °C |
| Exact Mass | 470.339600 |
| LogP | 6.80 |
| Vapour Pressure | 0.0±4.0 mmHg at 25°C |