Home
Products
Tsugaric acid A
| Product Name | Tsugaric acid A |
| Price: | Inquiry |
| Catalog No.: | CN07514 |
| CAS No.: | 174391-64-1 |
| Molecular Formula: | C32H50O4 |
| Molecular Weight: | 498.8 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The sclerotium of Poria cocos (Schw.) Wolf |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCCC(C1CCC2(C1(C)CCC1=C2CCC2C1(C)CCC(C2(C)C)OC(=O)C)C)C(=O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tsugaric acid A can significantly inhibit superoxide anion formation. Tsugaric acid A also protects human keratinocytes against damage induced by ultraviolet B (UV B) light. Tsugaric acid A can protect keratinocytes from photodamage. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 577.3±50.0 °C at 760 mmHg |
| Flash Point | 174.4±23.6 °C |
| Exact Mass | 498.370911 |
| PSA | 63.60000 |
| LogP | 9.94 |
| Vapour Pressure | 0.0±3.4 mmHg at 25°C |