Home
Products
Aristolochic acid D
| Product Name | Aristolochic acid D |
| Price: | $275 / 5mg |
| Catalog No.: | CN01043 |
| CAS No.: | 17413-38-6 |
| Molecular Formula: | C17H11NO8 |
| Molecular Weight: | 357.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Aristolochia debilis Sieb. et Zucc |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)cc2c1cc([N+](=O)[O-])c1c2c2OCOc2cc1C(=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Aristolochic acid D is an aristolochic acid derivative isolated from stems of Aristolochia indica. Aristolochic acid is nephrotoxin and carcinogen[1]. |
| Density | 1.656 g/cm3 |
| Boiling Point | 689.5ºC at 760 mmHg |
| Flash Point | 370.8ºC |
| Exact Mass | 357.04800 |
| PSA | 131.04000 |
| LogP | 3.56550 |
| Vapour Pressure | 5.83E-20mmHg at 25°C |