Home
Products
Tomatine
| Product Name | Tomatine |
| Price: | $146 / 10mg |
| Catalog No.: | CN01032 |
| CAS No.: | 17406-45-0 |
| Molecular Formula: | C50H83NO21 |
| Molecular Weight: | 1034.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The fruits of Solanum lycopersicum. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OC2CCC3(C(C2)CCC2C3CCC3(C2CC2C3C(C)C3(O2)CCC(CN3)C)C)C)C(C(C1OC1OC(CO)C(C(C1OC1OC(CO)C(C(C1O)O)O)OC1OCC(C(C1O)O)O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tomatine is a glycoalkaloid, found in the tomato plant (Lycopersicon esculentum Mill.). Tomatine elicits neurotoxicity in RIP1 kinase and caspase-independent manner. Tomatine promotes the upregulation of nuclear apoptosis inducing factor (AIF) in neuroblastoma cells. Tomatine also inhibits 20S proteasome activity[1]. |
| In Vitro | Tomatine inhibits gastric carcinoma cell line (AGS), neuroblastoma cell line (SH-SY5Y) and non-small cell lung cancer cell line (A549) with IC50s of 2 µM, 1.6 µM and 1.1 µM, respectively[1]. |
| Density | 1.5±0.1 g/cm3 |
| Exact Mass | 1033.545776 |
| PSA | 337.86000 |
| LogP | 2.22 |