Home
Products
Bevirimat
| Product Name | Bevirimat |
| Price: | $234 / 10mg |
| Catalog No.: | CN07294 |
| CAS No.: | 174022-42-5 |
| Molecular Formula: | C36H56O6 |
| Molecular Weight: | 584.83 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Ziziphus jujuba |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(CC(C(=O)O)(C)C)O[C@H]1CC[C@]2([C@H](C1(C)C)CC[C@@]1([C@@H]2CC[C@H]2[C@@]1(C)CC[C@@]1([C@@H]2[C@@H](CC1)C(=C)C)C(=O)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Bevirimat(YK FH312; FH11327; MPC-4326) is an anti-HIV drug derived from a betulinic acid-like compound; is believed to inhibit HIV by a novel mechanism, so-called maturation inhibition.IC50 value:Target: Anti-HIVLike protease inhibitors, bevirimat and other maturation inhibitors interfere with protease processing of newly translated HIV polyprotein precursor, called gag. Bevirimat prevents this viral replication by specifically inhibiting cleavage of the capsid protein (CA) from the SP1 spacer protein. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 662.7±40.0 °C at 760 mmHg |
| Flash Point | 197.7±20.8 °C |
| Exact Mass | 584.407715 |
| PSA | 100.90000 |
| LogP | 10.15 |
| Vapour Pressure | 0.0±4.3 mmHg at 25°C |
| Storage condition | -20°C |