Home
Products
Dehydroabietic acid
| Product Name | Dehydroabietic acid |
| Price: | $77 / 10mg |
| Catalog No.: | CN08891 |
| CAS No.: | 1740-19-8 |
| Molecular Formula: | C20H28O2 |
| Molecular Weight: | 300.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The barks of Pinus yunnanensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC(=O)[C@]1(C)CCC[C@]2([C@H]1CCc1c2ccc(c1)C(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dehydroabietic acid possesses antiviral activity[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 425.1±34.0 °C at 760 mmHg |
| Flash Point | 202.5±20.3 °C |
| Exact Mass | 300.208923 |
| PSA | 37.30000 |
| LogP | 6.35 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Storage condition | ?20°C |