Home
Products
Gambogenic acid
| Product Name | Gambogenic acid |
| Price: | $219 / 20mg |
| Catalog No.: | CN06579 |
| CAS No.: | 173932-75-7 |
| Molecular Formula: | C38H46O8 |
| Molecular Weight: | 630.8 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The herbs of Garcinia hanburyi Hook. f. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCc1c(O)c(C/C=C(/CCC=C(C)C)C)c(c2c1O[C@]13C(=C[C@@H]4C[C@H]1C(O[C@@]3(C/C=C(C(=O)O)/C)C4=O)(C)C)C2=O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Gambogenic acid is an active ingredient in gamboge, with anticancer activity. Gambogenic acid acts as an effective inhibitor of EZH2, specifically and covalently binds to Cys668 within the EZH2-SET domain, and induces EZH2 ubiquitination[1]. |
| Target | EZH2[1] |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 818.6±65.0 °C at 760 mmHg |
| Flash Point | 253.0±27.8 °C |
| Exact Mass | 630.319275 |
| LogP | 9.42 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Storage condition | 2-8°C |