Home
Products
Corynoxine B
| Product Name | Corynoxine B |
| Price: | Inquiry |
| Catalog No.: | CN00756 |
| CAS No.: | 17391-18-3 |
| Molecular Formula: | C22H28N2O4 |
| Molecular Weight: | 384.47 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The vines of Uncaria rhynchopylla. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CO/C=C([C@H]1C[C@@H]2N(C[C@H]1CC)CC[C@@]12C(=O)Nc2c1cccc2)/C(=O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Corynoxine B is an oxindole alkaloid isolated from Uncaria rhynchophylla (Miq.) Jacks (Gouteng in Chinese); a Beclin-1-dependent autophagy inducer. IC50 value:Target: Autophagy inducerin vitro: Corynoxine B, a natural autophagy inducer, restores the deficient cytosolic translocation of HMGB1 and autophagy in cells overexpressing SNCA, which may be attributed to its ability to block SNCA-HMGB1 interaction [1].in vivo: Corynoxine B exhibited prolongation of the thiopental-induced hypnosis on oral administration in mice [2]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 560.8±50.0 °C at 760 mmHg |
| Flash Point | 293.0±30.1 °C |
| Exact Mass | 384.204895 |
| PSA | 67.87000 |
| LogP | 3.31 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Storage condition | -20°C |