Home
Products
Swertiamarin
| Product Name | Swertiamarin |
| Price: | $18 / 20mg |
| Catalog No.: | CN03171 |
| CAS No.: | 17388-39-5 |
| Molecular Formula: | C16H22O10 |
| Molecular Weight: | 374.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Swertia bimaculata. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | C=C[C@H]1[C@@H](OC=C2[C@@]1(O)CCOC2=O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Swertiamarin, a secoiridoid glycoside found in genera of Enicostemma Species, confers anti-hyperglycemic and anti-hyperlipidemic effects[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 649.3±55.0 °C at 760 mmHg |
| Flash Point | 237.7±25.0 °C |
| Exact Mass | 374.121307 |
| PSA | 155.14000 |
| LogP | -3.15 |
| Vapour Pressure | 0.0±4.4 mmHg at 25°C |
| Storage condition | ?20°C |