Home
Products
2'-Hydroxyflavanone
| Product Name | 2'-Hydroxyflavanone |
| Price: | Inquiry |
| Catalog No.: | CN04394 |
| CAS No.: | 17348-76-4 |
| Molecular Formula: | C15H12O3 |
| Molecular Weight: | 240.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The stem barks of Garcinia malaccensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccccc1C1CC(=O)c2c(O1)cccc2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 184.0±35.0 °C at 760 mmHg |
| Flash Point | 65.1±25.9 °C |
| Exact Mass | 164.008514 |
| PSA | 46.53000 |
| LogP | 1.96 |
| Vapour Pressure | 0.7±0.4 mmHg at 25°C |