Home
Products
Rhoifolin
| Product Name | Rhoifolin |
| Price: | $62 / 20mg |
| Catalog No.: | CN05482 |
| CAS No.: | 17306-46-6 |
| Molecular Formula: | C27H30O14 |
| Molecular Weight: | 578.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The leaves of Turpinia arguya Seem. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc(O)c3c(c2)oc(cc3=O)c2ccc(cc2)O)[C@@H]([C@H]([C@@H]1O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Rhoifolin is a flavone glycoside isolated from Citrus grandis (L.) Osbeck leaves. Rhoifolin is beneficial for diabetic complications through enhanced adiponectin secretion, tyrosine phosphorylation of insulin receptor-β and glucose transporter 4 (GLUT 4) translocation[1]. Rhoifolin ameliorates titanium particle-stimulated osteolysis and attenuates osteoclastogenesis via RANKL-induced NF-κB and MAPK pathways[2]. |
| Target | NF-κB insulin receptor-β MAPK |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 916.5±65.0 °C at 760 mmHg |
| Flash Point | 305.4±27.8 °C |
| Exact Mass | 578.163574 |
| PSA | 228.97000 |
| LogP | 1.72 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 0-6°C |