Home
Products
2-Amino-3-carboxy-1,4-naphthoquinone
| Product Name | 2-Amino-3-carboxy-1,4-naphthoquinone |
| Price: | $511 / 5mg |
| Catalog No.: | CN05867 |
| CAS No.: | 173043-38-4 |
| Molecular Formula: | C11H7NO4 |
| Molecular Weight: | 217.18 g/mol |
| Purity: | >=98% |
| Type of Compound: | Quinones |
| Physical Desc.: | Powder |
| Source: | The herbs of Rubia yunnanensis Diels |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC(=O)C1=C(O)c2ccccc2C(=O)C1=N |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 2-Amino-3-carboxy-1,4-naphthoquinone is the electron transfer mediator. 2-Amino-3-carboxy-1,4-naphthoquinone changes glucose metabolism of the homofermentative lactic acid bacteria[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 380.9±42.0 °C at 760 mmHg |
| Flash Point | 184.1±27.9 °C |
| Exact Mass | 217.037506 |
| PSA | 97.46000 |
| LogP | 0.15 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |