Home
Products
Isocucurbitacin B
| Product Name | Isocucurbitacin B |
| Price: | Inquiry |
| Catalog No.: | CN07327 |
| CAS No.: | 17278-28-3 |
| Molecular Formula: | C32H46O8 |
| Molecular Weight: | 558.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Cucumis melo |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)OC(/C=C/C(=O)[C@@]([C@H]1[C@H](O)C[C@@]2([C@]1(C)CC(=O)[C@@]1([C@H]2CC=C2[C@H]1CC(=O)[C@H](C2(C)C)O)C)C)(O)C)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isocucurbitacin B is a potent cytotoxic compound isolated from Helicteres rswa L. (Sterculiaceae). Isocucurbitacin B possesses anti-tumor acticity[1][2]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 702.4±60.0 °C at 760 mmHg |
| Flash Point | 219.9±26.4 °C |
| Exact Mass | 558.319275 |
| PSA | 138.20000 |
| LogP | 2.06 |
| Vapour Pressure | 0.0±5.0 mmHg at 25°C |