Home
Products
Mudanpioside C
| Product Name | Mudanpioside C |
| Price: | $103 / 10mg |
| Catalog No.: | CN09645 |
| CAS No.: | 172760-03-1 |
| Molecular Formula: | C30H32O13 |
| Molecular Weight: | 600.57 g/mol |
| Purity: | >=98% |
| Type of Compound: | Monoterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Paeonia lactiflora Pall. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC1C(OC(C(C1O)O)COC(=O)c1ccc(cc1)O)OC12CC3C2(COC(=O)c2ccccc2)C2OC1(C)CC3(O2)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Use of Mudanpioside C | Mudanpioside C is a monoteepenoid isolated from Paeonia lactiflora Pall . |
| Description | Mudanpioside C is a monoteepenoid isolated from Paeonia lactiflora Pall . |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 789.1±60.0 °C at 760 mmHg |
| Flash Point | 258.6±26.4 °C |
| Exact Mass | 600.184265 |
| PSA | 190.67000 |
| Storage condition | 2-8℃ |