Home
Products
2-(Hydroxymethyl)anthraquinone
| Product Name | 2-(Hydroxymethyl)anthraquinone |
| Price: | $117 / 20mg |
| Catalog No.: | CN05973 |
| CAS No.: | 17241-59-7 |
| Molecular Formula: | C15H10O3 |
| Molecular Weight: | 238.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Yellow powder |
| Source: | The dried inner bark (taheebo) of Tabebuia impetiginosa. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OCc1ccc2c(c1)C(=O)c1c(C2=O)cccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 2-(Hydroxymethyl)anthraquinone is used as a photoremovable protecting group (PRPG) to chemically cage sex pheromone (e.g. (Z)-11-hexadecen-1-ol (sex pheromone of Chilo infuscatellussnellen))[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 472.9±34.0 °C at 760 mmHg |
| Flash Point | 253.9±22.2 °C |
| Exact Mass | 238.062988 |
| PSA | 54.37000 |
| LogP | 2.20 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Storage condition | 2-8°C |