Home
Products
Dihydrodaidzein
| Product Name | Dihydrodaidzein |
| Price: | Inquiry |
| Catalog No.: | CN04892 |
| CAS No.: | 17238-05-0 |
| Molecular Formula: | C15H12O4 |
| Molecular Weight: | 256.26 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The seeds of Glycine max. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc(cc1)C1COc2c(C1=O)ccc(c2)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dihydrodaidzein is one of the most prominent dietary phytoestrogens. |
| Target | Human Endogenous Metabolite |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 529.5±50.0 °C at 760 mmHg |
| Flash Point | 206.9±23.6 °C |
| Exact Mass | 256.073547 |
| PSA | 66.76000 |
| LogP | 2.79 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |