Home
Products
Cauloside A
| Product Name | Cauloside A |
| Price: | $336 / 5mg |
| Catalog No.: | CN07474 |
| CAS No.: | 17184-21-3 |
| Molecular Formula: | C35H56O8 |
| Molecular Weight: | 604.81 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Caulophyllum robustum |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@]1(C)[C@H](CC[C@]2([C@H]1CC[C@@]1([C@@H]2CC=C2[C@@]1(C)CC[C@@]1([C@H]2CC(CC1)(C)C)C(=O)O)C)C)O[C@@H]1OC[C@@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cauloside A (Leontoside A) is a saponin isolated from Dipsacus asper roots. Cauloside A has potent antifungal activity[1][2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 719.3±60.0 °C at 760 mmHg |
| Flash Point | 219.7±26.4 °C |
| Exact Mass | 604.397522 |
| PSA | 136.68000 |
| LogP | 7.75 |
| Vapour Pressure | 0.0±5.3 mmHg at 25°C |