Home
Products
S-Adenosyl-L-Methtonine
| Product Name | S-Adenosyl-L-Methtonine |
| Price: | Inquiry |
| Catalog No.: | CN01962 |
| CAS No.: | 17176-17-9 |
| Molecular Formula: | C15H22N6O5S |
| Molecular Weight: | 398.44 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | C[S+](C[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1cnc2c1ncnc2N)CCC(C(=O)[O-])N |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | S-Adenosyl-DL-methionine is a derivative of Ademetionine (HY-B0617). Ademetionine is an intermediate metabolite of methionine[1]. |
| Exact Mass | 570.156677 |
| PSA | 273.51000 |
| LogP | 1.33920 |
| Storage condition | −20°C |