Home
Products
Myrislignan
| Product Name | Myrislignan |
| Price: | $117 / 20mg |
| Catalog No.: | CN07008 |
| CAS No.: | 171485-39-5 |
| Molecular Formula: | C21H26O6 |
| Molecular Weight: | 374.43 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | White powder |
| Source: | The seeds of Myristica fragrans Houtt. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=CCc1cc(OC)c(c(c1)OC)O[C@H]([C@@H](c1ccc(c(c1)OC)O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Myrislignan, a lignan isolated from Myristica fragrans Houtt, possesses anti-inflammatory activities. Myrislignan attenuates LPS-induced inflammation reaction in murine macrophage cells through inhibition of NF-kB signalling pathway activation[1]. |
| Density | 1.167 |
| Boiling Point | 537.6±50.0 °C at 760 mmHg |
| Flash Point | 278.9±30.1 °C |
| Exact Mass | 374.172943 |
| PSA | 77.38000 |
| LogP | 2.54 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Storage condition | 2-8C |