Home
Products
Dihydroactinidiolide
| Product Name | Dihydroactinidiolide |
| Price: | Inquiry |
| Catalog No.: | CN09247 |
| CAS No.: | 17092-92-1 |
| Molecular Formula: | C11H16O2 |
| Molecular Weight: | 180.25 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The essential oil of green tea. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1C=C2[C@@](O1)(C)CCCC2(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dihydroactinidiolide, existing in plant leaves and fruits, is a potent plant growth inhibitor, a regulator of gene expression and is responsible for photo acclimation in Arabidopsis. Dihydroactinidiolide has antioxidant activity, antibacterial activity, anticancer activity and neuroprotective effect[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 296.1±9.0 °C at 760 mmHg |
| Flash Point | 120.2±16.1 °C |
| Exact Mass | 180.115036 |
| PSA | 26.30000 |
| LogP | 2.26 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |