Home
Products
Pseudobufarenogin
| Product Name | Pseudobufarenogin |
| Price: | $321 / 10mg |
| Catalog No.: | CN02333 |
| CAS No.: | 17008-69-4 |
| Molecular Formula: | C24H32O6 |
| Molecular Weight: | 416.51 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The glandular body of Bufo bufo |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@H]1CC[C@]2([C@@H](C1)CC[C@@H]1[C@@H]2C(=O)[C@H](O)[C@]2([C@]1(O)CC[C@@H]2c1ccc(=O)oc1)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Pseudobufarenogin is a natural compound extracted from toad species with unknown details. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 635.8±55.0 °C at 760 mmHg |
| Flash Point | 218.7±25.0 °C |
| Exact Mass | 416.219879 |
| PSA | 107.97000 |
| LogP | 0.71 |
| Vapour Pressure | 0.0±4.2 mmHg at 25°C |
| Storage condition | 2-8℃ |