Home
Products
Protostemotinine
| Product Name | Protostemotinine |
| Price: | Inquiry |
| Catalog No.: | CN00763 |
| CAS No.: | 169534-85-4 |
| Molecular Formula: | C23H29NO6 |
| Molecular Weight: | 415.48 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Stemona japonica |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC1=C(C)C(=O)OC21C(=O)C(=C1C32CCC(N3CCCC1)C1CC(C(=O)O1)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Protostemotinine is an alkaloid isolated from the roots and rhizomes of Stemona sessilifolia. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 690.7±55.0 °C at 760 mmHg |
| Flash Point | 371.5±31.5 °C |
| Exact Mass | 415.199493 |
| PSA | 82.14000 |
| LogP | 1.86 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |