Home
Products
3-O-Acetyl-16 alpha-hydroxydehydrotrametenolic acid
| Product Name | 3-O-Acetyl-16 alpha-hydroxydehydrotrametenolic acid |
| Price: | $277 / 5mg |
| Catalog No.: | CN07528 |
| CAS No.: | 168293-14-9 |
| Molecular Formula: | C32H48O5 |
| Molecular Weight: | 512.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The sclerotium of Poria cocos(Schw.) Wolf |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCCC(C1C(O)CC2(C1(C)CC=C1C2=CCC2C1(C)CCC(C2(C)C)OC(=O)C)C)C(=O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3-O-Acetyl-16α-hydroxydehydrotrametenolic acid, an anti-inflammatory triterpenoid, inhibits NO production and iNOS expression in LPS-stimulated Raw264.7 cells[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 624.7±55.0 °C at 760 mmHg |
| Flash Point | 192.7±25.0 °C |
| Exact Mass | 512.350159 |
| LogP | 7.81 |
| Vapour Pressure | 0.0±4.1 mmHg at 25°C |