Home
Products
3-O-Acetyl-16 alpha-hydroxytrametenolic acid
| Product Name | 3-O-Acetyl-16 alpha-hydroxytrametenolic acid |
| Price: | $293 / 5mg |
| Catalog No.: | CN07502 |
| CAS No.: | 168293-13-8 |
| Molecular Formula: | C32H50O5 |
| Molecular Weight: | 514.8 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The sclerotium of Poria cocos(Schw.)Wolf |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCCC(C1C(O)CC2(C1(C)CCC1=C2CCC2C1(C)CCC(C2(C)C)OC(=O)C)C)C(=O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3-O-Acetyl-16α-hydroxytrametenolic acid (Compound 3) is a triterpene found in Poria cocos, with anti-oxidant and anti-cancer activity[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 606.9±55.0 °C at 760 mmHg |
| Flash Point | 185.1±25.0 °C |
| Exact Mass | 514.365845 |
| LogP | 8.23 |
| Vapour Pressure | 0.0±3.9 mmHg at 25°C |