Home
Products
Mearnsetin
| Product Name | Mearnsetin |
| Price: | Inquiry |
| Catalog No.: | CN04781 |
| CAS No.: | 16805-10-0 |
| Molecular Formula: | C16H12O8 |
| Molecular Weight: | 332.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The barks of Eucalyptus globulus Labill. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(O)cc(cc1O)c1oc2cc(O)cc(c2c(=O)c1O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 699.4±55.0 °C at 760 mmHg |
| Flash Point | 264.6±25.0 °C |
| Exact Mass | 332.053223 |
| PSA | 140.59000 |
| LogP | 2.11 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |