Home
Products
Avasimibe
| Product Name | Avasimibe |
| Price: | Inquiry |
| Catalog No.: | CN00120 |
| CAS No.: | 166518-60-1 |
| Molecular Formula: | C29H43NO4S |
| Molecular Weight: | 501.72 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(NS(=O)(=O)Oc1c(cccc1C(C)C)C(C)C)Cc1c(cc(cc1C(C)C)C(C)C)C(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Avasimibe is an oral inhibitor of acyl-Coenzyme A:cholesterol acyltransferase (ACAT) with IC50s of 24 and 9.2 µM for ACAT1 and ACAT2, respectively. |
| Density | 1.1±0.1 g/cm3 |
| Exact Mass | 501.291290 |
| PSA | 80.85000 |
| LogP | 9.34 |
| Storage condition | room temp |