Home
Products
Linezolid
| Product Name | Linezolid |
| Price: | Inquiry |
| Catalog No.: | CN00151 |
| CAS No.: | 165800-03-3 |
| Molecular Formula: | C16H20FN3O4 |
| Molecular Weight: | 337.35 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)NC[C@@H]1OC(=O)N(C1)c1ccc(c(c1)F)N1CCOCC1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Linezolid (PNU-100766) is a synthetic antibiotic used for the treatment of serious infections caused by Gram-positive bacteria that are resistant to several other antibiotics. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 585.5±50.0 °C at 760 mmHg |
| Flash Point | 307.9±30.1 °C |
| Exact Mass | 337.143799 |
| PSA | 71.11000 |
| LogP | 0.30 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Storage condition | Store at RT |