Home
Products
L-Stepholidine
| Product Name | L-Stepholidine |
| Price: | Inquiry |
| Catalog No.: | CN01293 |
| CAS No.: | 16562-13-3 |
| Molecular Formula: | C19H21NO4 |
| Molecular Weight: | 327.37 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Stephania japonica. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2CCN3[C@H](c2cc1O)Cc1c(C3)c(OC)c(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | L-Stepholidine (Stepholidine), an alkaloid extract of the Chinese herb Stephania intermedia, is the first compound known to exhibit mixed dopamine D1 receptor agonist/D2 antagonist properties. L-Stepholidine (Stepholidine) has neuroprotective effect and inhibits heroin-induced reinstatement. L-Stepholidine (Stepholidine) is a potential medication for the treatment of opiate addiction[1][2][3]. |
| Target | Dopamine D1 receptor[1] Dopamine D2 receptor[1] |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 524.0±50.0 °C at 760 mmHg |
| Flash Point | 270.7±30.1 °C |
| Exact Mass | 327.147064 |
| PSA | 62.16000 |
| LogP | 2.16 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |