Home
Products
Kukoamine B
| Product Name | Kukoamine B |
| Price: | $146 / 10mg |
| Catalog No.: | CN01033 |
| CAS No.: | 164991-67-7 |
| Molecular Formula: | C28H42N4O6 |
| Molecular Weight: | 530.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Oil |
| Source: | The root barks of Lycium chinense |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | NCCCN(C(=O)CCc1ccc(c(c1)O)O)CCCCNCCCNC(=O)CCc1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Kukoamine B is a component of Lycii Cortex, with anti-oxidant, anti-acute inflammatory and anti-diabetic properties[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 844.3±65.0 °C at 760 mmHg |
| Flash Point | 464.4±34.3 °C |
| Exact Mass | 530.310425 |
| LogP | 0.00 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |