Home
Products
2'-Deoxyadenosine
| Product Name | 2'-Deoxyadenosine |
| Price: | Inquiry |
| Catalog No.: | CN00022 |
| CAS No.: | 16373-93-6 |
| Molecular Formula: | C10H13N5O3 |
| Molecular Weight: | 251.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Typhonium giganteum Engl. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@H](C[C@@H]1O)n1cnc2c1ncnc2N.O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 2'-Deoxyadenosine monohydrate is a deoxyribonucleoside. A building block in the chemical synthesis. |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 627.2±65.0 °C at 760 mmHg |
| Flash Point | 333.1±34.3 °C |
| PSA | 119.31000 |
| LogP | -0.55 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Storage condition | 2-8°C |