Home
Products
Cimifugin 4'-O-beta-D-glucopyranoside
| Product Name | Cimifugin 4'-O-beta-D-glucopyranoside |
| Price: | $491 / 5mg |
| Catalog No.: | CN03505 |
| CAS No.: | 1632110-81-6 |
| Molecular Formula: | C22H28O11 |
| Molecular Weight: | 468.45 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The roots of Saposhnikovia divaricata |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OC(C2Oc3c(C2)c(OC)c2c(c3)oc(cc2=O)CO)(C)C)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cimifugin 4'-O-β-D-glucopyranoside is a derivative of cimifugin. |
| Density | 1.53±0.1 g/cm3(Predicted) |
| Boiling Point | 746.2±60.0 °C(Predicted) |