Home
Products
Cimicifugoside H1
| Product Name | Cimicifugoside H1 |
| Price: | $380 / 10mg |
| Catalog No.: | CN07355 |
| CAS No.: | 163046-73-9 |
| Molecular Formula: | C35H52O9 |
| Molecular Weight: | 616.78 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Cimicifuga foetida |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O[C@H]1[C@H](O)CO[C@H]([C@@H]1O)O[C@H]1CC[C@]23[C@H](C1(C)C)CC=C1[C@@]3(C2)[C@@H](O)C[C@]2([C@@]1(C)CC(=O)[C@@H]2[C@@H](CC(=O)[C@@H]1OC1(C)C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cimicifugoside H-1, a cyclolanostanol xyloside, is a major constituent of C. foetida L. extract. Cimicifugoside H-1 inhibits bone resorption and ovariectomy-induced bone loss[1][2][3]. |
| Density | 1.31±0.1 g/cm3 at 760 mmHg |
| Boiling Point | 748.9±60.0 °C at 760 mmHg |
| Exact Mass | 674.36700 |
| PSA | 172.35000 |
| LogP | 2.63390 |
| Storage condition | 2-8°C |