Home
Products
Kaempferol-7-O-D-glucopyranoside
| Product Name | Kaempferol-7-O-D-glucopyranoside |
| Price: | $321 / 10mg |
| Catalog No.: | CN05236 |
| CAS No.: | 16290-07-6 |
| Molecular Formula: | C21H20O11 |
| Molecular Weight: | 448.38 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Hosta plantaginea |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc(O)c3c(c2)oc(c(c3=O)O)c2ccc(cc2)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Kaempferol-7-O-β-D-glucopyranoside is a flavonoid isolated from Malus pumila Mill. flowers, has antioxidative, anti-inflammatory and procoagulant activitives[1][2][3]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 810.2±65.0 °C at 760 mmHg |
| Flash Point | 287.0±27.8 °C |
| Exact Mass | 448.100555 |
| PSA | 190.28000 |
| LogP | -0.19 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Storage condition | ?20°C |