Home
Products
Polygalaxanthone III
| Product Name | Polygalaxanthone III |
| Price: | $117 / 20mg |
| Catalog No.: | CN05799 |
| CAS No.: | 162857-78-5 |
| Molecular Formula: | C25H28O15 |
| Molecular Weight: | 568.39 g/mol |
| Purity: | >=98% |
| Type of Compound: | Xanthones |
| Physical Desc.: | Powder |
| Source: | The roots of Polygala tenuifolia Willd. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COc1cc2c(cc1O)oc1c(c2=O)c(O)c(c(c1)O)[C@@H]1O[C@H](CO[C@@H]2OC[C@]([C@H]2O)(O)CO)[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Polygalaxanthone III is extracted from polygala tenuifolia wild, has inhibitory effect towards CYP450 enzyme. Polygalaxanthone III inhibits chlorzoxazone 6-hydroxylation catalyzed by CYP2E1 with an IC50 of 50.56 μM[1]. |
| Density | 1.83 |
| Boiling Point | 973.2±65.0 °C at 760 mmHg |
| Flash Point | 327.7±27.8 °C |
| Exact Mass | 568.142822 |
| LogP | -0.31 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |