Home
Products
Polygalasaponin V
| Product Name | Polygalasaponin V |
| Price: | $219 / 10mg |
| Catalog No.: | CN07566 |
| CAS No.: | 162857-65-0 |
| Molecular Formula: | C58H94O27 |
| Molecular Weight: | 1222.59 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Polygala japonica Houtt. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](OC(=O)[C@]23CC[C@@]4(C(=CC[C@H]5[C@@]4(C)CC[C@@H]4[C@]5(C)C[C@@H]([C@@H]([C@@]4(C)CO)O[C@@H]4O[C@H](CO)[C@H]([C@@H]([C@H]4O)O)O)O)[C@@H]3CC(CC2)(C)C)C)[C@@H]([C@H]([C@@H]1O)O[C@@H]1OC[C@]([C@H]1O)(O)CO)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O[C@@H]1OC[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Polygalasaponin V is a triterpenoid saponin isolated from the aerial parts of Polygala japonica. Polygala japonica has been a folk medicine herb used as expectorant, anti-inflammatory, antibacterial and antidepressant agents in the south of China[1]. |
| Density | 1.5±0.1 g/cm3 |
| Exact Mass | 1222.598267 |
| LogP | 1.94 |
| Storage condition | 2-8°C |