Home
Products
Hydroxyvalerenic acid
| Product Name | Hydroxyvalerenic acid |
| Price: | Inquiry |
| Catalog No.: | CN09015 |
| CAS No.: | 1619-16-5 |
| Molecular Formula: | C15H22O3 |
| Molecular Weight: | 250.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Valeriana officinalis L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C[C@@H]1CC[C@H](C2=C(C[C@H]([C@H]12)O)C)/C=C(/C(=O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Hydroxyvalerenic acid is isolated from Verbena officinalis, has a low toxicity with IC50 values of 123 and 165 μM against GLC4 and COLO 320 cells, respectively[1]. |
| Density | 1.14 g/cm3 |
| Boiling Point | 426ºC at 760 mmHg |
| Flash Point | 225.6ºC |
| Exact Mass | 250.15700 |
| PSA | 57.53000 |
| LogP | 2.76070 |
| Vapour Pressure | 4.82E-09mmHg at 25°C |