Home
Products
Segetalin A
| Product Name | Segetalin A |
| Price: | Inquiry |
| Catalog No.: | CN00757 |
| CAS No.: | 161875-97-4 |
| Molecular Formula: | C31H43N7O6 |
| Molecular Weight: | 609.72 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Vaccaria segetalis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1CNC(=O)C(C)NC(=O)C(NC(=O)C(NC(=O)C2N(C(=O)C(N1)C(C)C)CCC2)C(C)C)Cc1c[nH]c2c1cccc2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Segetalin A is the compound isolated from the seeds of Vaccaria hispanica[1]. |
| Exact Mass | 609.32700 |
| PSA | 199.05000 |
| LogP | 1.41970 |
| Storage condition | 2-8°C |