Home
Products
Palmatrubine
| Product Name | Palmatrubine |
| Price: | $204 / 20mg |
| Catalog No.: | CN01224 |
| CAS No.: | 16176-68-4 |
| Molecular Formula: | C20H20NO4 |
| Molecular Weight: | 338.38 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Tinospora sagittata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2CC[n+]3c(c2cc1OC)cc1c(c3)c(O)c(cc1)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Palmaturbine is isolated from T. sinensis[1]. |
| Exact Mass | 338.13900 |
| PSA | 51.80000 |
| LogP | 3.08180 |