Home
Products
Vincamine
| Product Name | Vincamine |
| Price: | $31 / 20mg |
| Catalog No.: | CN01287 |
| CAS No.: | 1617-90-9 |
| Molecular Formula: | C21H26N2O3 |
| Molecular Weight: | 354.44 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Cryst. |
| Source: | The herbs of Catharanthus roseus (L.) G. Don. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC(=O)[C@@]1(O)C[C@]2(CC)CCCN3[C@@H]2c2n1c1ccccc1c2CC3 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Vincamine is a peripheral vasodilator, that increases blood flow to the brain. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 508.9±50.0 °C at 760 mmHg |
| Flash Point | 261.6±30.1 °C |
| Exact Mass | 354.194336 |
| PSA | 54.70000 |
| LogP | 3.10 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Storage condition | 2~8°C |