Home
Products
Lupeol acetate
| Product Name | Lupeol acetate |
| Price: | $351 / 10mg |
| Catalog No.: | CN07465 |
| CAS No.: | 1617-68-1 |
| Molecular Formula: | C32H52O2 |
| Molecular Weight: | 468.77 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The stem barks of Himatanthus drasticus (Mart.) Plumel. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)OC1CC[C@]2([C@H](C1(C)C)CC[C@@]1([C@@H]2CC[C@H]2[C@@]1(C)CC[C@@]1([C@@H]2[C@@H](CC1)C(=C)C)C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Lupeol acetate, a derivative of Lupeol, suppresses the progression of rheumatoid arthritis (RA) by inhibiting the activation of macrophages and osteoclastogenesis through downregulations of TNF-α, IL-1β, MCP-1, COX-2, VEGF and granzyme B[1]. |
| Density | 1.01g/cm3 |
| Boiling Point | 502.7ºC at 760mmHg |
| Flash Point | 254.7ºC |
| Exact Mass | 468.39700 |
| PSA | 26.30000 |
| LogP | 8.59560 |
| Vapour Pressure | 3.1E-10mmHg at 25°C |