Home
Products
(S)-N-Glycidylphthalimide
| Product Name | (S)-N-Glycidylphthalimide |
| Price: | Inquiry |
| Catalog No.: | CN01060 |
| CAS No.: | 161596-47-0 |
| Molecular Formula: | C11H9NO3 |
| Molecular Weight: | 203.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The heartwoods of Pseudolarix amabilis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1N(C[C@@H]2OC2)C(=O)c2c1cccc2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 347.4±15.0 °C at 760 mmHg |
| Flash Point | 163.9±20.4 °C |
| Exact Mass | 203.058243 |
| PSA | 49.91000 |
| LogP | 1.60 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |