Home
Products
8-Hydroxybergapten
| Product Name | 8-Hydroxybergapten |
| Price: | $263 / 5mg |
| Catalog No.: | CN06150 |
| CAS No.: | 1603-47-0 |
| Molecular Formula: | C12H8O5 |
| Molecular Weight: | 232.19 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The roots of Angelica dahurica. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c2ccc(=O)oc2c(c2c1cco2)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 8-hydroxybergapten is O-methylated by cell-free extracts of Ruta cells to isopimpinellin, in reactions mediated by discrete O-methyltransferases. 8-hydroxybergapten has excellent anti-wrinkle effect[1][2]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 488.2±45.0 °C at 760 mmHg |
| Flash Point | 249.1±28.7 °C |
| Exact Mass | 232.037170 |
| PSA | 72.81000 |
| LogP | 0.96 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |