Home
Products
Salvianolic acid F
| Product Name | Salvianolic acid F |
| Price: | $556 / 5mg |
| Catalog No.: | CN03722 |
| CAS No.: | 158732-59-3 |
| Molecular Formula: | C17H14O6 |
| Molecular Weight: | 314.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The roots of Salvia miltiorrhiza Bge. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC(=O)C=Cc1ccc(c(c1C=Cc1ccc(c(c1)O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Salvianolic acid F is a synthesized polyphenolic acid[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 636.8±55.0 °C at 760 mmHg |
| Flash Point | 352.9±28.0 °C |
| Exact Mass | 314.079041 |
| LogP | 3.95 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |