Home
Products
Gypenoside A
| Product Name | Gypenoside A |
| Price: | $204 / 10mg |
| Catalog No.: | CN07275 |
| CAS No.: | 157752-01-7 |
| Molecular Formula: | C46H74O17 |
| Molecular Weight: | 899.08 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Gynostemma pentaphyllum (Thunb.) Makino. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O=CC12CCC(C(C1CCC1(C2CCC2C1(C)CCC2C1(O)CC(OC1O)C=C(C)C)C)(C)C)OC1OCC(C(C1OC1OC(C)C(C(C1O)O)O)OC1OCC(C(C1O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Gypenoside A is a natural compound isolaated from Gynostemma pentaphyllum Makino[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 515.8±60.0 °C at 760 mmHg |
| Flash Point | 265.7±32.9 °C |
| Exact Mass | 336.078003 |
| LogP | 3.18 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Storage condition | 2-8°C |