Home
Products
Bacoside A3
| Product Name | Bacoside A3 |
| Price: | $277 / 5mg |
| Catalog No.: | CN07222 |
| CAS No.: | 157408-08-7 |
| Molecular Formula: | C47H76O18 |
| Molecular Weight: | 929.11 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Bacopa monnieri |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OC2CCC3(C(C2(C)C)CCC2(C3CCC3C42COC2(C4)C3C(C)(O)CC(O2)C=C(C)C)C)C)C(C(C1O)OC1OC(CO)C(C(C1O)O)O)OC1OC(C(C1O)O)CO |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Bacoside A3, a triterpenoid saponin, is one of the major active constituents in Bacopa monnieri. Bacoside A3 has neuroprotective activity[1]. |
| Density | 1.43 |
| Exact Mass | 928.50300 |
| PSA | 276.14000 |
| Storage condition | 2-8°C |